C20H30N6O4S2 — CID 110659049
N-[5-[4-[2-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110659049) has the molecular formula C20H30N6O4S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[5-[4-[2-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[4-[2-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110659049 |
| Molecular Formula | C20H30N6O4S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[5-[4-[2-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)N2CCN(CC(=O)c3cc(C)n(C(C)(C)C)c3C)CC2)s1 |
| InChI | InChI=1S/C20H30N6O4S2/c1-13-11-16(14(2)26(13)20(4,5)6)17(28)12-24-7-9-25(10-8-24)32(29,30)19-23-22-18(31-19)21-15(3)27/h11H,7-10,12H2,1-6H3,(H,21,22,27) |
| InChIKey | XCTIEKVFTKXXKM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|