C21H30N6O4S2 — CID 110659337
N-[5-[4-[2-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110659337) has the molecular formula C21H30N6O4S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[5-[4-[2-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[4-[2-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110659337 |
| Molecular Formula | C21H30N6O4S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-[5-[4-[2-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)N2CCN(CC(=O)c3cc(C)n(C4CCCC4)c3C)CC2)s1 |
| InChI | InChI=1S/C21H30N6O4S2/c1-14-12-18(15(2)27(14)17-6-4-5-7-17)19(29)13-25-8-10-26(11-9-25)33(30,31)21-24-23-20(32-21)22-16(3)28/h12,17H,4-11,13H2,1-3H3,(H,22,23,28) |
| InChIKey | YAGNVMNYMFWQTA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|