C14H15N3O3S2 — CID 155815410
ethyl 2-[(4-methoxyphenyl)carbamothioylamino]-1,3-thiazole-4-carboxylate (PubChem CID 155815410) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is ethyl 2-[(4-methoxyphenyl)carbamothioylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(4-methoxyphenyl)carbamothioylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155815410 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | ethyl 2-[(4-methoxyphenyl)carbamothioylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=S)Nc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C14H15N3O3S2/c1-3-20-12(18)11-8-22-14(16-11)17-13(21)15-9-4-6-10(19-2)7-5-9/h4-8H,3H2,1-2H3,(H2,15,16,17,21) |
| InChIKey | OAQKOYDCQFXHNP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|