C17H17BrN6O2S3 — CID 2254108
(2R)-2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[5-(4-bromophenyl)-4H-1,3,4-thiadiazin-2-yl]butanamide (PubChem CID 2254108) has the molecular formula C17H17BrN6O2S3 and a molecular weight of 513.47 g/mol. Its IUPAC name is (2R)-2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[5-(4-bromophenyl)-4H-1,3,4-thiadiazin-2-yl]butanamide.
| Compound Name | (2R)-2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[5-(4-bromophenyl)-4H-1,3,4-thiadiazin-2-yl]butanamide |
|---|---|
| PubChem CID | 2254108 |
| Molecular Formula | C17H17BrN6O2S3 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | (2R)-2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[5-(4-bromophenyl)-4H-1,3,4-thiadiazin-2-yl]butanamide |
| SMILES | CC[C@@H](Sc1nnc(NC(C)=O)s1)C(=O)NC1=NNC(c2ccc(Br)cc2)=CS1 |
| InChI | InChI=1S/C17H17BrN6O2S3/c1-3-13(28-17-24-23-16(29-17)19-9(2)25)14(26)20-15-22-21-12(8-27-15)10-4-6-11(18)7-5-10/h4-8,13,21H,3H2,1-2H3,(H,19,23,25)(H,20,22,26)/t13-/m1/s1 |
| InChIKey | AXCYDXJAJLRGPK-CYBMUJFWSA-N |
| XLogP | 3.85 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|