C13H14IN5OS — CID 21232397
2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide (PubChem CID 21232397) has the molecular formula C13H14IN5OS and a molecular weight of 415.26 g/mol. Its IUPAC name is 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide.
| Compound Name | 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide |
|---|---|
| PubChem CID | 21232397 |
| Molecular Formula | C13H14IN5OS |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide |
| SMILES | CCC(Sc1ncnc(N)n1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C13H14IN5OS/c1-2-10(21-13-17-7-16-12(15)19-13)11(20)18-9-5-3-8(14)4-6-9/h3-7,10H,2H2,1H3,(H,18,20)(H2,15,16,17,19) |
| InChIKey | SNKCKVRZPNUVIY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|