C14H16ClN5OS — CID 7345794
(2S)-N-(4-chlorophenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanamide (PubChem CID 7345794) has the molecular formula C14H16ClN5OS and a molecular weight of 337.84 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 7345794 |
| Molecular Formula | C14H16ClN5OS |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanamide |
| SMILES | CC[C@H](Sc1nc(N)cc(N)n1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClN5OS/c1-2-10(22-14-19-11(16)7-12(17)20-14)13(21)18-9-5-3-8(15)4-6-9/h3-7,10H,2H2,1H3,(H,18,21)(H4,16,17,19,20)/t10-/m0/s1 |
| InChIKey | VLWDWSPDVONSJP-JTQLQIEISA-N |
| XLogP | 2.80 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |