C14H18N6O3S2 — CID 17017883
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)butanamide (PubChem CID 17017883) has the molecular formula C14H18N6O3S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)butanamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 17017883 |
| Molecular Formula | C14H18N6O3S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)butanamide |
| SMILES | CCC(Sc1nc(N)cc(N)n1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H18N6O3S2/c1-2-10(24-14-19-11(15)7-12(16)20-14)13(21)18-8-3-5-9(6-4-8)25(17,22)23/h3-7,10H,2H2,1H3,(H,18,21)(H2,17,22,23)(H4,15,16,19,20) |
| InChIKey | IAWSJIXZFIWOAB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |