C8H13N3O2S — CID 106926292
3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanehydrazide (PubChem CID 106926292) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanehydrazide.
| Compound Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 106926292 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanehydrazide |
| SMILES | Cc1nc(SCCC(=O)NN)oc1C |
| InChI | InChI=1S/C8H13N3O2S/c1-5-6(2)13-8(10-5)14-4-3-7(12)11-9/h3-4,9H2,1-2H3,(H,11,12) |
| InChIKey | YFKFLZZJQMJJLR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|