5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid

C12H17NO2S — CID 102924386

IUPAC5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid
SMILESCc1cc(C)nc(SCCCCC(=O)O)c1
InChIInChI=1S/C12H17NO2S/c1-9-7-10(2)13-11(8-9)16-6-4-3-5-12(14)15/h7-8H,3-6H2,1-2H3,(H,14,15)
InChIKeyJVGSUBYWTQKBCQ-UHFFFAOYSA-N
MW239.34 g/mol
LogP3.05
Rot. Bonds6

About 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid

5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid (PubChem CID 102924386) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid.

Molecular Properties

Compound Name5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid
PubChem CID102924386
Molecular FormulaC12H17NO2S
Molecular Weight239.34 g/mol
Exact Mass239.10
IUPAC Name5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid
SMILESCc1cc(C)nc(SCCCCC(=O)O)c1
InChIInChI=1S/C12H17NO2S/c1-9-7-10(2)13-11(8-9)16-6-4-3-5-12(14)15/h7-8H,3-6H2,1-2H3,(H,14,15)
InChIKeyJVGSUBYWTQKBCQ-UHFFFAOYSA-N
XLogP3.05
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.34
LogP ≤ 53.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid?
The IUPAC name of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid (CID 102924386) is 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid.
What is the SMILES notation for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid?
The canonical SMILES for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid is Cc1cc(C)nc(SCCCCC(=O)O)c1.
What is the InChIKey of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid?
The InChIKey is JVGSUBYWTQKBCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2S/c1-9-7-10(2)13-11(8-9)16-6-4-3-5-12(14)15/h7-8H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid?
5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid has a molecular weight of 239.34 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pentanoic acid is sourced from PubChem (CID 102924386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).