C13H15F2NO3 — CID 119369647
(2R)-2-[(2,2-difluoro-2-phenylacetyl)amino]-3-methylbutanoic acid (PubChem CID 119369647) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is (2R)-2-[(2,2-difluoro-2-phenylacetyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2,2-difluoro-2-phenylacetyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119369647 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2R)-2-[(2,2-difluoro-2-phenylacetyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)C(F)(F)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H15F2NO3/c1-8(2)10(11(17)18)16-12(19)13(14,15)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,16,19)(H,17,18)/t10-/m1/s1 |
| InChIKey | ADNSHQGNDYLWKR-SNVBAGLBSA-N |
| XLogP | 2.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |