About propan-2-ylsulfanylcarbamic acid;hydrochloride
propan-2-ylsulfanylcarbamic acid;hydrochloride (PubChem CID 88673990) has the molecular formula C4H10ClNO2S
and a molecular weight of 171.65 g/mol. Its IUPAC name is propan-2-ylsulfanylcarbamic acid;hydrochloride.
Molecular Properties
| Compound Name | propan-2-ylsulfanylcarbamic acid;hydrochloride |
| PubChem CID | 88673990 |
| Molecular Formula | C4H10ClNO2S |
| Molecular Weight | 171.65 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | propan-2-ylsulfanylcarbamic acid;hydrochloride |
| SMILES | CC(C)SNC(=O)O.Cl |
| InChI | InChI=1S/C4H9NO2S.ClH/c1-3(2)8-5-4(6)7;/h3,5H,1-2H3,(H,6,7);1H |
| InChIKey | AXLDQCOKMJJNCV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.65 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ylsulfanylcarbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylsulfanylcarbamic acid;hydrochloride?
The IUPAC name of propan-2-ylsulfanylcarbamic acid;hydrochloride (CID 88673990) is propan-2-ylsulfanylcarbamic acid;hydrochloride.
What is the SMILES notation for propan-2-ylsulfanylcarbamic acid;hydrochloride?
The canonical SMILES for propan-2-ylsulfanylcarbamic acid;hydrochloride is CC(C)SNC(=O)O.Cl.
What is the InChIKey of propan-2-ylsulfanylcarbamic acid;hydrochloride?
The InChIKey is AXLDQCOKMJJNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2S.ClH/c1-3(2)8-5-4(6)7;/h3,5H,1-2H3,(H,6,7);1H.
What are the key properties of propan-2-ylsulfanylcarbamic acid;hydrochloride?
propan-2-ylsulfanylcarbamic acid;hydrochloride has a molecular weight of 171.65 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylsulfanylcarbamic acid;hydrochloride is sourced from PubChem (CID 88673990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).