C13H11F13NNaO3 — CID 146077694
sodium 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)hexanoate (PubChem CID 146077694) has the molecular formula C13H11F13NNaO3 and a molecular weight of 499.20 g/mol. Its IUPAC name is sodium 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)hexanoate.
| Compound Name | sodium 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)hexanoate |
|---|---|
| PubChem CID | 146077694 |
| Molecular Formula | C13H11F13NNaO3 |
| Molecular Weight | 499.20 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | sodium 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)hexanoate |
| SMILES | CCCCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H12F13NO3.Na/c1-2-3-4-5(6(28)29)27-7(30)8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26;/h5H,2-4H2,1H3,(H,27,30)(H,28,29);/q;+1/p-1 |
| InChIKey | OQOPWDUCSMVCMC-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|