C10H11ClF6NO3- — CID 7038436
(2S)-2-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]hexanoate (PubChem CID 7038436) has the molecular formula C10H11ClF6NO3- and a molecular weight of 342.64 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]hexanoate.
| Compound Name | (2S)-2-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]hexanoate |
|---|---|
| PubChem CID | 7038436 |
| Molecular Formula | C10H11ClF6NO3- |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | (2S)-2-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]hexanoate |
| SMILES | CCCC[C@H](NC(=O)C(F)(F)C(F)(F)C(F)(F)Cl)C(=O)[O-] |
| InChI | InChI=1S/C10H12ClF6NO3/c1-2-3-4-5(6(19)20)18-7(21)8(12,13)9(14,15)10(11,16)17/h5H,2-4H2,1H3,(H,18,21)(H,19,20)/p-1/t5-/m0/s1 |
| InChIKey | HHXODEOITZHNPD-YFKPBYRVSA-M |
| XLogP | 1.51 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|