C20H13F24N2NaO4 — CID 146051291
sodium 2,6-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoylamino)hexanoate (PubChem CID 146051291) has the molecular formula C20H13F24N2NaO4 and a molecular weight of 824.28 g/mol. Its IUPAC name is sodium 2,6-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoylamino)hexanoate.
| Compound Name | sodium 2,6-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoylamino)hexanoate |
|---|---|
| PubChem CID | 146051291 |
| Molecular Formula | C20H13F24N2NaO4 |
| Molecular Weight | 824.28 g/mol |
| Exact Mass | 824.04 |
| IUPAC Name | sodium 2,6-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoylamino)hexanoate |
| SMILES | O=C([O-])C(CCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.[Na+] |
| InChI | InChI=1S/C20H14F24N2O4.Na/c21-7(22)11(25,26)15(33,34)19(41,42)17(37,38)13(29,30)9(49)45-4-2-1-3-5(6(47)48)46-10(50)14(31,32)18(39,40)20(43,44)16(35,36)12(27,28)8(23)24;/h5,7-8H,1-4H2,(H,45,49)(H,46,50)(H,47,48);/q;+1/p-1 |
| InChIKey | BKJFFBYPSSPBPF-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|