C16H16F16N2O2 — CID 4149699
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(3-morpholin-4-ylpropyl)nonanamide (PubChem CID 4149699) has the molecular formula C16H16F16N2O2 and a molecular weight of 572.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(3-morpholin-4-ylpropyl)nonanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(3-morpholin-4-ylpropyl)nonanamide |
|---|---|
| PubChem CID | 4149699 |
| Molecular Formula | C16H16F16N2O2 |
| Molecular Weight | 572.28 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(3-morpholin-4-ylpropyl)nonanamide |
| SMILES | O=C(NCCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H16F16N2O2/c17-8(18)10(19,20)12(23,24)14(27,28)16(31,32)15(29,30)13(25,26)11(21,22)9(35)33-2-1-3-34-4-6-36-7-5-34/h8H,1-7H2,(H,33,35) |
| InChIKey | XVABDQKTNXBPKP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|