C10H11ClF6N2O3 — CID 89001692
(2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoyl chloride (PubChem CID 89001692) has the molecular formula C10H11ClF6N2O3 and a molecular weight of 356.65 g/mol. Its IUPAC name is (2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoyl chloride.
| Compound Name | (2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoyl chloride |
|---|---|
| PubChem CID | 89001692 |
| Molecular Formula | C10H11ClF6N2O3 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoyl chloride |
| SMILES | O=C(Cl)[C@H](CCCCNC(=O)C(F)(F)F)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11ClF6N2O3/c11-6(20)5(19-8(22)10(15,16)17)3-1-2-4-18-7(21)9(12,13)14/h5H,1-4H2,(H,18,21)(H,19,22)/t5-/m0/s1 |
| InChIKey | GXWDYKSTOHIMGQ-YFKPBYRVSA-N |
| XLogP | 1.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|