C35H65F6N3O2 — CID 139942216
2,2,2-trifluoro-N-[9-[7-(octylamino)heptyl]-16-[(2,2,2-trifluoroacetyl)amino]hexadecyl]acetamide (PubChem CID 139942216) has the molecular formula C35H65F6N3O2 and a molecular weight of 673.91 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[9-[7-(octylamino)heptyl]-16-[(2,2,2-trifluoroacetyl)amino]hexadecyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[9-[7-(octylamino)heptyl]-16-[(2,2,2-trifluoroacetyl)amino]hexadecyl]acetamide |
|---|---|
| PubChem CID | 139942216 |
| Molecular Formula | C35H65F6N3O2 |
| Molecular Weight | 673.91 g/mol |
| Exact Mass | 673.50 |
| IUPAC Name | 2,2,2-trifluoro-N-[9-[7-(octylamino)heptyl]-16-[(2,2,2-trifluoroacetyl)amino]hexadecyl]acetamide |
| SMILES | CCCCCCCCNCCCCCCCC(CCCCCCCCNC(=O)C(F)(F)F)CCCCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C35H65F6N3O2/c1-2-3-4-5-13-20-27-42-28-21-14-8-11-18-25-31(26-19-12-9-16-23-30-44-33(46)35(39,40)41)24-17-10-6-7-15-22-29-43-32(45)34(36,37)38/h31,42H,2-30H2,1H3,(H,43,45)(H,44,46) |
| InChIKey | RTJJUOBGZXKFOR-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.91 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|