C12H18F6N2O2 — CID 123568887
2,2,2-trifluoro-N-[5-[(5,5,5-trifluoro-4-oxopentyl)amino]pentyl]acetamide (PubChem CID 123568887) has the molecular formula C12H18F6N2O2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[5-[(5,5,5-trifluoro-4-oxopentyl)amino]pentyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[5-[(5,5,5-trifluoro-4-oxopentyl)amino]pentyl]acetamide |
|---|---|
| PubChem CID | 123568887 |
| Molecular Formula | C12H18F6N2O2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[5-[(5,5,5-trifluoro-4-oxopentyl)amino]pentyl]acetamide |
| SMILES | O=C(CCCNCCCCCNC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6N2O2/c13-11(14,15)9(21)5-4-7-19-6-2-1-3-8-20-10(22)12(16,17)18/h19H,1-8H2,(H,20,22) |
| InChIKey | FUEMNGJPOUHWJE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|