C16H28F3NO3 — CID 162408955
ethyl 5-[3-[(2,2,2-trifluoroacetyl)amino]propyl]nonanoate (PubChem CID 162408955) has the molecular formula C16H28F3NO3 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl 5-[3-[(2,2,2-trifluoroacetyl)amino]propyl]nonanoate.
| Compound Name | ethyl 5-[3-[(2,2,2-trifluoroacetyl)amino]propyl]nonanoate |
|---|---|
| PubChem CID | 162408955 |
| Molecular Formula | C16H28F3NO3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | ethyl 5-[3-[(2,2,2-trifluoroacetyl)amino]propyl]nonanoate |
| SMILES | CCCCC(CCCNC(=O)C(F)(F)F)CCCC(=O)OCC |
| InChI | InChI=1S/C16H28F3NO3/c1-3-5-8-13(9-6-11-14(21)23-4-2)10-7-12-20-15(22)16(17,18)19/h13H,3-12H2,1-2H3,(H,20,22) |
| InChIKey | ZULITJOKEJLIDJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|