C13H15F7NO5- — CID 71408430
(4S)-5-butoxy-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-oxopentanoate (PubChem CID 71408430) has the molecular formula C13H15F7NO5- and a molecular weight of 398.25 g/mol. Its IUPAC name is (4S)-5-butoxy-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-oxopentanoate.
| Compound Name | (4S)-5-butoxy-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 71408430 |
| Molecular Formula | C13H15F7NO5- |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (4S)-5-butoxy-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-oxopentanoate |
| SMILES | CCCCOC(=O)[C@H](CCC(=O)[O-])NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H16F7NO5/c1-2-3-6-26-9(24)7(4-5-8(22)23)21-10(25)11(14,15)12(16,17)13(18,19)20/h7H,2-6H2,1H3,(H,21,25)(H,22,23)/p-1/t7-/m0/s1 |
| InChIKey | VUGBEXMWWSCEAD-ZETCQYMHSA-M |
| XLogP | 1.18 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|