C10H11F5NO5- — CID 71408414
(4S)-5-ethoxy-5-oxo-4-(2,2,3,3,3-pentafluoropropanoylamino)pentanoate (PubChem CID 71408414) has the molecular formula C10H11F5NO5- and a molecular weight of 320.19 g/mol. Its IUPAC name is (4S)-5-ethoxy-5-oxo-4-(2,2,3,3,3-pentafluoropropanoylamino)pentanoate.
| Compound Name | (4S)-5-ethoxy-5-oxo-4-(2,2,3,3,3-pentafluoropropanoylamino)pentanoate |
|---|---|
| PubChem CID | 71408414 |
| Molecular Formula | C10H11F5NO5- |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (4S)-5-ethoxy-5-oxo-4-(2,2,3,3,3-pentafluoropropanoylamino)pentanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)[O-])NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F5NO5/c1-2-21-7(19)5(3-4-6(17)18)16-8(20)9(11,12)10(13,14)15/h5H,2-4H2,1H3,(H,16,20)(H,17,18)/p-1/t5-/m0/s1 |
| InChIKey | PAALKBRXIUEPEQ-YFKPBYRVSA-M |
| XLogP | -0.24 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|