C21H17F21N4O5 — CID 636180
ethyl 6-[bis(2,2,3,3,4,4,4-heptafluorobutanoylamino)methylideneamino]-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexanoate (PubChem CID 636180) has the molecular formula C21H17F21N4O5 and a molecular weight of 804.35 g/mol. Its IUPAC name is ethyl 6-[bis(2,2,3,3,4,4,4-heptafluorobutanoylamino)methylideneamino]-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexanoate.
| Compound Name | ethyl 6-[bis(2,2,3,3,4,4,4-heptafluorobutanoylamino)methylideneamino]-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexanoate |
|---|---|
| PubChem CID | 636180 |
| Molecular Formula | C21H17F21N4O5 |
| Molecular Weight | 804.35 g/mol |
| Exact Mass | 804.09 |
| IUPAC Name | ethyl 6-[bis(2,2,3,3,4,4,4-heptafluorobutanoylamino)methylideneamino]-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexanoate |
| SMILES | CCOC(=O)C(CCCCN=C(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)NC(=O)C(F)(F)C(F)(F)C(F)(F)F)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H17F21N4O5/c1-2-51-8(47)7(44-9(48)13(22,23)16(28,29)19(34,35)36)5-3-4-6-43-12(45-10(49)14(24,25)17(30,31)20(37,38)39)46-11(50)15(26,27)18(32,33)21(40,41)42/h7H,2-6H2,1H3,(H,44,48)(H2,43,45,46,49,50) |
| InChIKey | WMMDRBXJRMYMHW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|