C12H18F3NO5S — CID 95771967
diethyl (2R)-2-[[2-(trifluoromethylsulfanyl)acetyl]amino]pentanedioate (PubChem CID 95771967) has the molecular formula C12H18F3NO5S and a molecular weight of 345.34 g/mol. Its IUPAC name is diethyl (2R)-2-[[2-(trifluoromethylsulfanyl)acetyl]amino]pentanedioate.
| Compound Name | diethyl (2R)-2-[[2-(trifluoromethylsulfanyl)acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 95771967 |
| Molecular Formula | C12H18F3NO5S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | diethyl (2R)-2-[[2-(trifluoromethylsulfanyl)acetyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@@H](NC(=O)CSC(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C12H18F3NO5S/c1-3-20-10(18)6-5-8(11(19)21-4-2)16-9(17)7-22-12(13,14)15/h8H,3-7H2,1-2H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | RVSCICZZJJZMJI-MRVPVSSYSA-N |
| XLogP | 1.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |