C8H12F3NO3S — CID 115923960
4-[[2-(trifluoromethylsulfanyl)acetyl]amino]pentanoic acid (PubChem CID 115923960) has the molecular formula C8H12F3NO3S and a molecular weight of 259.25 g/mol. Its IUPAC name is 4-[[2-(trifluoromethylsulfanyl)acetyl]amino]pentanoic acid.
| Compound Name | 4-[[2-(trifluoromethylsulfanyl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 115923960 |
| Molecular Formula | C8H12F3NO3S |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 4-[[2-(trifluoromethylsulfanyl)acetyl]amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)CSC(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3S/c1-5(2-3-7(14)15)12-6(13)4-16-8(9,10)11/h5H,2-4H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | BNNORFJENNUQIP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |