C11H18N2O6 — CID 134182114
4-[[2-(3-carboxypropanoylamino)acetyl]amino]pentanoic acid (PubChem CID 134182114) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is 4-[[2-(3-carboxypropanoylamino)acetyl]amino]pentanoic acid.
| Compound Name | 4-[[2-(3-carboxypropanoylamino)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 134182114 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-[[2-(3-carboxypropanoylamino)acetyl]amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)CNC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H18N2O6/c1-7(2-4-10(16)17)13-9(15)6-12-8(14)3-5-11(18)19/h7H,2-6H2,1H3,(H,12,14)(H,13,15)(H,16,17)(H,18,19) |
| InChIKey | ZCGYPICPXNKJDY-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |