C10H19N3O4 — CID 82847762
5-[[2-[(2-aminoacetyl)amino]acetyl]amino]hexanoic acid (PubChem CID 82847762) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-[[2-[(2-aminoacetyl)amino]acetyl]amino]hexanoic acid.
| Compound Name | 5-[[2-[(2-aminoacetyl)amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 82847762 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 5-[[2-[(2-aminoacetyl)amino]acetyl]amino]hexanoic acid |
| SMILES | CC(CCCC(=O)O)NC(=O)CNC(=O)CN |
| InChI | InChI=1S/C10H19N3O4/c1-7(3-2-4-10(16)17)13-9(15)6-12-8(14)5-11/h7H,2-6,11H2,1H3,(H,12,14)(H,13,15)(H,16,17) |
| InChIKey | KMKHIXNLHLQLHO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |