4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid

C10H17F2NO4 — CID 103206025

IUPAC4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid
SMILESCC(CCC(=O)O)NC(=O)CCOCC(F)F
InChIInChI=1S/C10H17F2NO4/c1-7(2-3-10(15)16)13-9(14)4-5-17-6-8(11)12/h7-8H,2-6H2,1H3,(H,13,14)(H,15,16)
InChIKeyUEOBWVOQVRIFEU-UHFFFAOYSA-N
MW253.24 g/mol
LogP1.03
Rot. Bonds9

About 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid

4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid (PubChem CID 103206025) has the molecular formula C10H17F2NO4 and a molecular weight of 253.24 g/mol. Its IUPAC name is 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid.

Molecular Properties

Compound Name4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid
PubChem CID103206025
Molecular FormulaC10H17F2NO4
Molecular Weight253.24 g/mol
Exact Mass253.11
IUPAC Name4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid
SMILESCC(CCC(=O)O)NC(=O)CCOCC(F)F
InChIInChI=1S/C10H17F2NO4/c1-7(2-3-10(15)16)13-9(14)4-5-17-6-8(11)12/h7-8H,2-6H2,1H3,(H,13,14)(H,15,16)
InChIKeyUEOBWVOQVRIFEU-UHFFFAOYSA-N
XLogP1.03
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.24
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid?
The IUPAC name of 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid (CID 103206025) is 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid.
What is the SMILES notation for 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid?
The canonical SMILES for 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid is CC(CCC(=O)O)NC(=O)CCOCC(F)F.
What is the InChIKey of 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid?
The InChIKey is UEOBWVOQVRIFEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO4/c1-7(2-3-10(15)16)13-9(14)4-5-17-6-8(11)12/h7-8H,2-6H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid?
4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid has a molecular weight of 253.24 g/mol, XLogP of 1.03, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid is sourced from PubChem (CID 103206025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).