C10H17F2NO4 — CID 107562818
(2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid (PubChem CID 107562818) has the molecular formula C10H17F2NO4 and a molecular weight of 253.24 g/mol. Its IUPAC name is (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid.
| Compound Name | (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107562818 |
| Molecular Formula | C10H17F2NO4 |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)CCOCC(F)F)C(=O)O |
| InChI | InChI=1S/C10H17F2NO4/c1-2-3-7(10(15)16)13-9(14)4-5-17-6-8(11)12/h7-8H,2-6H2,1H3,(H,13,14)(H,15,16)/t7-/m1/s1 |
| InChIKey | BKAXKAZGPKWEJZ-SSDOTTSWSA-N |
| XLogP | 1.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|