C7H10F3NO3S — CID 115731360
2-methyl-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]propanoic acid (PubChem CID 115731360) has the molecular formula C7H10F3NO3S and a molecular weight of 245.22 g/mol. Its IUPAC name is 2-methyl-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 115731360 |
| Molecular Formula | C7H10F3NO3S |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-methyl-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]propanoic acid |
| SMILES | CC(CNC(=O)CSC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H10F3NO3S/c1-4(6(13)14)2-11-5(12)3-15-7(8,9)10/h4H,2-3H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | NETNEBLGKKWERH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |