C7H10F3NO3S2 — CID 115731477
2-[2-[[2-(trifluoromethylsulfanyl)acetyl]amino]ethylsulfanyl]acetic acid (PubChem CID 115731477) has the molecular formula C7H10F3NO3S2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-[2-[[2-(trifluoromethylsulfanyl)acetyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[2-(trifluoromethylsulfanyl)acetyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 115731477 |
| Molecular Formula | C7H10F3NO3S2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2-[2-[[2-(trifluoromethylsulfanyl)acetyl]amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)CSC(F)(F)F |
| InChI | InChI=1S/C7H10F3NO3S2/c8-7(9,10)16-3-5(12)11-1-2-15-4-6(13)14/h1-4H2,(H,11,12)(H,13,14) |
| InChIKey | UVKATGKHRQWSCO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|