C12H13F2NO3S — CID 120526546
2-[2-[[2-(3,4-difluorophenyl)acetyl]amino]ethylsulfanyl]acetic acid (PubChem CID 120526546) has the molecular formula C12H13F2NO3S and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-[2-[[2-(3,4-difluorophenyl)acetyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[2-(3,4-difluorophenyl)acetyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526546 |
| Molecular Formula | C12H13F2NO3S |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-[2-[[2-(3,4-difluorophenyl)acetyl]amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13F2NO3S/c13-9-2-1-8(5-10(9)14)6-11(16)15-3-4-19-7-12(17)18/h1-2,5H,3-4,6-7H2,(H,15,16)(H,17,18) |
| InChIKey | KXGXOXXOPMRKMF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|