C23H39F5N2O4 — CID 91699014
octyl 4-methyl-2-[[4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoyl]amino]pentanoate (PubChem CID 91699014) has the molecular formula C23H39F5N2O4 and a molecular weight of 502.57 g/mol. Its IUPAC name is octyl 4-methyl-2-[[4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoyl]amino]pentanoate.
| Compound Name | octyl 4-methyl-2-[[4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 91699014 |
| Molecular Formula | C23H39F5N2O4 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | octyl 4-methyl-2-[[4-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)pentanoyl]amino]pentanoate |
| SMILES | CCCCCCCCOC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H39F5N2O4/c1-6-7-8-9-10-11-12-34-20(32)18(14-16(4)5)29-19(31)17(13-15(2)3)30-21(33)22(24,25)23(26,27)28/h15-18H,6-14H2,1-5H3,(H,29,31)(H,30,33) |
| InChIKey | XODXAAKTXPDSFS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|