C21H24F15NO3 — CID 91745600
octyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate (PubChem CID 91745600) has the molecular formula C21H24F15NO3 and a molecular weight of 623.40 g/mol. Its IUPAC name is octyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate.
| Compound Name | octyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91745600 |
| Molecular Formula | C21H24F15NO3 |
| Molecular Weight | 623.40 g/mol |
| Exact Mass | 623.15 |
| IUPAC Name | octyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C21H24F15NO3/c1-3-5-6-7-8-9-11-40-13(38)12(10-4-2)37-14(39)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)20(32,33)21(34,35)36/h4,12H,2-3,5-11H2,1H3,(H,37,39) |
| InChIKey | MHRHOQBWGDXVLW-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.40 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|