C10H12ClF6NO3 — CID 3548401
2-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]hexanoic acid (PubChem CID 3548401) has the molecular formula C10H12ClF6NO3 and a molecular weight of 343.65 g/mol. Its IUPAC name is 2-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]hexanoic acid.
| Compound Name | 2-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 3548401 |
| Molecular Formula | C10H12ClF6NO3 |
| Molecular Weight | 343.65 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-[(4-chloro-2,2,3,3,4,4-hexafluorobutanoyl)amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)Cl)C(=O)O |
| InChI | InChI=1S/C10H12ClF6NO3/c1-2-3-4-5(6(19)20)18-7(21)8(12,13)9(14,15)10(11,16)17/h5H,2-4H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | HHXODEOITZHNPD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|