C11H17F3N2O4 — CID 120537909
2-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]hexanoic acid (PubChem CID 120537909) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]hexanoic acid.
| Compound Name | 2-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120537909 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)CC(=O)NCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H17F3N2O4/c1-2-3-4-7(10(19)20)16-9(18)5-8(17)15-6-11(12,13)14/h7H,2-6H2,1H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | NGOBDYNNXUCKHD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|