C13H24N2O5 — CID 131721921
(2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]hexanoic acid (PubChem CID 131721921) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is (2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 131721921 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (2S)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H24N2O5/c1-5-6-7-9(11(17)18)15-10(16)8-14-12(19)20-13(2,3)4/h9H,5-8H2,1-4H3,(H,14,19)(H,15,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | CKCWEWNUFYCDIQ-VIFPVBQESA-N |
| XLogP | 1.27 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |