C15H28N2O5 — CID 87902559
(2R)-2-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoic acid (PubChem CID 87902559) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2R)-2-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoic acid.
| Compound Name | (2R)-2-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 87902559 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (2R)-2-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoic acid |
| SMILES | CCCC[C@@H](NC(=O)C(C)(C)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H28N2O5/c1-7-8-9-10(11(18)19)16-12(20)15(5,6)17-13(21)22-14(2,3)4/h10H,7-9H2,1-6H3,(H,16,20)(H,17,21)(H,18,19)/t10-/m1/s1 |
| InChIKey | DLRLKMGWSWYEDC-SNVBAGLBSA-N |
| XLogP | 2.05 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |