C14H25F2NO4 — CID 54143537
(2S)-2-(2,2-difluorodecanoylamino)-4-hydroxybutanoic acid (PubChem CID 54143537) has the molecular formula C14H25F2NO4 and a molecular weight of 309.35 g/mol. Its IUPAC name is (2S)-2-(2,2-difluorodecanoylamino)-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-(2,2-difluorodecanoylamino)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 54143537 |
| Molecular Formula | C14H25F2NO4 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (2S)-2-(2,2-difluorodecanoylamino)-4-hydroxybutanoic acid |
| SMILES | CCCCCCCCC(F)(F)C(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C14H25F2NO4/c1-2-3-4-5-6-7-9-14(15,16)13(21)17-11(8-10-18)12(19)20/h11,18H,2-10H2,1H3,(H,17,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | OCTJIFVUSZOQHO-NSHDSACASA-N |
| XLogP | 2.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|