C16H29NO5 — CID 87788888
(2S)-4-hydroxy-2-(2-oxododecanoylamino)butanoic acid (PubChem CID 87788888) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(2-oxododecanoylamino)butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-(2-oxododecanoylamino)butanoic acid |
|---|---|
| PubChem CID | 87788888 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | (2S)-4-hydroxy-2-(2-oxododecanoylamino)butanoic acid |
| SMILES | CCCCCCCCCCC(=O)C(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C16H29NO5/c1-2-3-4-5-6-7-8-9-10-14(19)15(20)17-13(11-12-18)16(21)22/h13,18H,2-12H2,1H3,(H,17,20)(H,21,22)/t13-/m0/s1 |
| InChIKey | SWFHMRZFXBGLQO-ZDUSSCGKSA-N |
| XLogP | 2.04 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|