C8H12Cl3NO5S — CID 108731643
4-ethylsulfonyl-2-[(2,2,2-trichloroacetyl)amino]butanoic acid (PubChem CID 108731643) has the molecular formula C8H12Cl3NO5S and a molecular weight of 340.61 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-[(2,2,2-trichloroacetyl)amino]butanoic acid.
| Compound Name | 4-ethylsulfonyl-2-[(2,2,2-trichloroacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 108731643 |
| Molecular Formula | C8H12Cl3NO5S |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | 4-ethylsulfonyl-2-[(2,2,2-trichloroacetyl)amino]butanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)C(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C8H12Cl3NO5S/c1-2-18(16,17)4-3-5(6(13)14)12-7(15)8(9,10)11/h5H,2-4H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | RAMYACGUYOXXQZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|