C11H21NO5S — CID 108731672
2-(2,2-dimethylpropanoylamino)-4-ethylsulfonylbutanoic acid (PubChem CID 108731672) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-4-ethylsulfonylbutanoic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-4-ethylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 108731672 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-4-ethylsulfonylbutanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H21NO5S/c1-5-18(16,17)7-6-8(9(13)14)12-10(15)11(2,3)4/h8H,5-7H2,1-4H3,(H,12,15)(H,13,14) |
| InChIKey | UQCPCFRGEQUBNP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |