C13H26N2OS — CID 113270547
2-carbamothioyl-N-heptan-2-yl-2-methylbutanamide (PubChem CID 113270547) has the molecular formula C13H26N2OS and a molecular weight of 258.43 g/mol. Its IUPAC name is 2-carbamothioyl-N-heptan-2-yl-2-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-heptan-2-yl-2-methylbutanamide |
|---|---|
| PubChem CID | 113270547 |
| Molecular Formula | C13H26N2OS |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-carbamothioyl-N-heptan-2-yl-2-methylbutanamide |
| SMILES | CCCCCC(C)NC(=O)C(C)(CC)C(N)=S |
| InChI | InChI=1S/C13H26N2OS/c1-5-7-8-9-10(3)15-12(16)13(4,6-2)11(14)17/h10H,5-9H2,1-4H3,(H2,14,17)(H,15,16) |
| InChIKey | VWLXQDFTAMTHES-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|