About 2-butan-2-yloxy-N'-hydroxyethanimidamide
2-butan-2-yloxy-N'-hydroxyethanimidamide (PubChem CID 76883223) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-butan-2-yloxy-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-butan-2-yloxy-N'-hydroxyethanimidamide |
| PubChem CID | 76883223 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2-butan-2-yloxy-N'-hydroxyethanimidamide |
| SMILES | CCC(C)OCC(N)=NO |
| InChI | InChI=1S/C6H14N2O2/c1-3-5(2)10-4-6(7)8-9/h5,9H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | JBCINNQAJNEHGN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yloxy-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yloxy-N'-hydroxyethanimidamide?
The IUPAC name of 2-butan-2-yloxy-N'-hydroxyethanimidamide (CID 76883223) is 2-butan-2-yloxy-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-butan-2-yloxy-N'-hydroxyethanimidamide?
The canonical SMILES for 2-butan-2-yloxy-N'-hydroxyethanimidamide is CCC(C)OCC(N)=NO.
What is the InChIKey of 2-butan-2-yloxy-N'-hydroxyethanimidamide?
The InChIKey is JBCINNQAJNEHGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2/c1-3-5(2)10-4-6(7)8-9/h5,9H,3-4H2,1-2H3,(H2,7,8).
What are the key properties of 2-butan-2-yloxy-N'-hydroxyethanimidamide?
2-butan-2-yloxy-N'-hydroxyethanimidamide has a molecular weight of 146.19 g/mol, XLogP of 0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yloxy-N'-hydroxyethanimidamide is sourced from PubChem (CID 76883223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).