About 4-ethoxy-N'-hydroxypentanimidamide
4-ethoxy-N'-hydroxypentanimidamide (PubChem CID 89315184) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-ethoxy-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 4-ethoxy-N'-hydroxypentanimidamide |
| PubChem CID | 89315184 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 4-ethoxy-N'-hydroxypentanimidamide |
| SMILES | CCOC(C)CC/C(N)=N/O |
| InChI | InChI=1S/C7H16N2O2/c1-3-11-6(2)4-5-7(8)9-10/h6,10H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | WYWKBJKCQUKJQA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N'-hydroxypentanimidamide?
The IUPAC name of 4-ethoxy-N'-hydroxypentanimidamide (CID 89315184) is 4-ethoxy-N'-hydroxypentanimidamide.
What is the SMILES notation for 4-ethoxy-N'-hydroxypentanimidamide?
The canonical SMILES for 4-ethoxy-N'-hydroxypentanimidamide is CCOC(C)CC/C(N)=N/O.
What is the InChIKey of 4-ethoxy-N'-hydroxypentanimidamide?
The InChIKey is WYWKBJKCQUKJQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-3-11-6(2)4-5-7(8)9-10/h6,10H,3-5H2,1-2H3,(H2,8,9).
What are the key properties of 4-ethoxy-N'-hydroxypentanimidamide?
4-ethoxy-N'-hydroxypentanimidamide has a molecular weight of 160.22 g/mol, XLogP of 0.94, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N'-hydroxypentanimidamide is sourced from PubChem (CID 89315184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).