About cyclopropylmethoxymethylcyclopropane;hydron
cyclopropylmethoxymethylcyclopropane;hydron (PubChem CID 175036707) has the molecular formula C8H16O+2
and a molecular weight of 128.22 g/mol. Its IUPAC name is cyclopropylmethoxymethylcyclopropane;hydron.
Molecular Properties
| Compound Name | cyclopropylmethoxymethylcyclopropane;hydron |
| PubChem CID | 175036707 |
| Molecular Formula | C8H16O+2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | cyclopropylmethoxymethylcyclopropane;hydron |
| SMILES | C1CC1COCC1CC1.[H+].[H+] |
| InChI | InChI=1S/C8H14O/c1-2-7(1)5-9-6-8-3-4-8/h7-8H,1-6H2/p+2 |
| InChIKey | SUPJPQUERPFJGM-UHFFFAOYSA-P |
| XLogP | 2.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopropylmethoxymethylcyclopropane;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethoxymethylcyclopropane;hydron?
The IUPAC name of cyclopropylmethoxymethylcyclopropane;hydron (CID 175036707) is cyclopropylmethoxymethylcyclopropane;hydron.
What is the SMILES notation for cyclopropylmethoxymethylcyclopropane;hydron?
The canonical SMILES for cyclopropylmethoxymethylcyclopropane;hydron is C1CC1COCC1CC1.[H+].[H+].
What is the InChIKey of cyclopropylmethoxymethylcyclopropane;hydron?
The InChIKey is SUPJPQUERPFJGM-UHFFFAOYSA-P. The full InChI is InChI=1S/C8H14O/c1-2-7(1)5-9-6-8-3-4-8/h7-8H,1-6H2/p+2.
What are the key properties of cyclopropylmethoxymethylcyclopropane;hydron?
cyclopropylmethoxymethylcyclopropane;hydron has a molecular weight of 128.22 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethoxymethylcyclopropane;hydron is sourced from PubChem (CID 175036707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).