C18H28F2O — CID 145027741
1-[[(3Z)-3,4-difluoro-5-methylidenehepta-1,3-dien-2-yl]oxymethyl]-4-propylcyclohexane (PubChem CID 145027741) has the molecular formula C18H28F2O and a molecular weight of 298.42 g/mol. Its IUPAC name is 1-[[(3Z)-3,4-difluoro-5-methylidenehepta-1,3-dien-2-yl]oxymethyl]-4-propylcyclohexane.
| Compound Name | 1-[[(3Z)-3,4-difluoro-5-methylidenehepta-1,3-dien-2-yl]oxymethyl]-4-propylcyclohexane |
|---|---|
| PubChem CID | 145027741 |
| Molecular Formula | C18H28F2O |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 1-[[(3Z)-3,4-difluoro-5-methylidenehepta-1,3-dien-2-yl]oxymethyl]-4-propylcyclohexane |
| SMILES | C=C(CC)/C(F)=C(/F)C(=C)OCC1CCC(CCC)CC1 |
| InChI | InChI=1S/C18H28F2O/c1-5-7-15-8-10-16(11-9-15)12-21-14(4)18(20)17(19)13(3)6-2/h15-16H,3-12H2,1-2H3/b18-17- |
| InChIKey | OAAHNRCDBAOASV-ZCXUNETKSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|