C17H26F2 — CID 143959577
1-[(4Z)-4,5-difluoro-6-methyl-3-methylidenehepta-4,6-dienyl]-4-ethylcyclohexane (PubChem CID 143959577) has the molecular formula C17H26F2 and a molecular weight of 268.39 g/mol. Its IUPAC name is 1-[(4Z)-4,5-difluoro-6-methyl-3-methylidenehepta-4,6-dienyl]-4-ethylcyclohexane.
| Compound Name | 1-[(4Z)-4,5-difluoro-6-methyl-3-methylidenehepta-4,6-dienyl]-4-ethylcyclohexane |
|---|---|
| PubChem CID | 143959577 |
| Molecular Formula | C17H26F2 |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-[(4Z)-4,5-difluoro-6-methyl-3-methylidenehepta-4,6-dienyl]-4-ethylcyclohexane |
| SMILES | C=C(C)/C(F)=C(/F)C(=C)CCC1CCC(CC)CC1 |
| InChI | InChI=1S/C17H26F2/c1-5-14-8-10-15(11-9-14)7-6-13(4)17(19)16(18)12(2)3/h14-15H,2,4-11H2,1,3H3/b17-16- |
| InChIKey | BEQKHYXMTDHJAX-MSUUIHNZSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|