C16H26F2O2 — CID 144714635
1-[[(2Z,4E)-2-ethoxy-3,4-difluorohexa-2,4-dienoxy]methyl]-4-methylcyclohexane (PubChem CID 144714635) has the molecular formula C16H26F2O2 and a molecular weight of 288.38 g/mol. Its IUPAC name is 1-[[(2Z,4E)-2-ethoxy-3,4-difluorohexa-2,4-dienoxy]methyl]-4-methylcyclohexane.
| Compound Name | 1-[[(2Z,4E)-2-ethoxy-3,4-difluorohexa-2,4-dienoxy]methyl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 144714635 |
| Molecular Formula | C16H26F2O2 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-[[(2Z,4E)-2-ethoxy-3,4-difluorohexa-2,4-dienoxy]methyl]-4-methylcyclohexane |
| SMILES | C/C=C(F)\C(F)=C(/COCC1CCC(C)CC1)OCC |
| InChI | InChI=1S/C16H26F2O2/c1-4-14(17)16(18)15(20-5-2)11-19-10-13-8-6-12(3)7-9-13/h4,12-13H,5-11H2,1-3H3/b14-4+,16-15- |
| InChIKey | GZLSVYMFSSYTJC-YDMLXHLBSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|