C15H22F2O — CID 143799471
1-[(1E,3E,5Z)-4-ethoxy-5,6-difluorohexa-1,3,5-trienyl]-4-methylcyclohexane (PubChem CID 143799471) has the molecular formula C15H22F2O and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-[(1E,3E,5Z)-4-ethoxy-5,6-difluorohexa-1,3,5-trienyl]-4-methylcyclohexane.
| Compound Name | 1-[(1E,3E,5Z)-4-ethoxy-5,6-difluorohexa-1,3,5-trienyl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 143799471 |
| Molecular Formula | C15H22F2O |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-[(1E,3E,5Z)-4-ethoxy-5,6-difluorohexa-1,3,5-trienyl]-4-methylcyclohexane |
| SMILES | CCOC(=C/C=C/C1CCC(C)CC1)/C(F)=C/F |
| InChI | InChI=1S/C15H22F2O/c1-3-18-15(14(17)11-16)6-4-5-13-9-7-12(2)8-10-13/h4-6,11-13H,3,7-10H2,1-2H3/b5-4+,14-11-,15-6+ |
| InChIKey | DJDYFCZGCKMRGK-FXOAVRTISA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|