C29H44F2O2 — CID 143291798
1-[4-[[(1Z,3E,5E)-1,2-difluoro-6-[(4-methylcyclohexyl)methoxy]hexa-1,3,5-trien-3-yl]oxymethyl]cyclohexyl]-4-ethenylcyclohexane (PubChem CID 143291798) has the molecular formula C29H44F2O2 and a molecular weight of 462.67 g/mol. Its IUPAC name is 1-[4-[[(1Z,3E,5E)-1,2-difluoro-6-[(4-methylcyclohexyl)methoxy]hexa-1,3,5-trien-3-yl]oxymethyl]cyclohexyl]-4-ethenylcyclohexane.
| Compound Name | 1-[4-[[(1Z,3E,5E)-1,2-difluoro-6-[(4-methylcyclohexyl)methoxy]hexa-1,3,5-trien-3-yl]oxymethyl]cyclohexyl]-4-ethenylcyclohexane |
|---|---|
| PubChem CID | 143291798 |
| Molecular Formula | C29H44F2O2 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | 1-[4-[[(1Z,3E,5E)-1,2-difluoro-6-[(4-methylcyclohexyl)methoxy]hexa-1,3,5-trien-3-yl]oxymethyl]cyclohexyl]-4-ethenylcyclohexane |
| SMILES | C=CC1CCC(C2CCC(COC(=C/C=C/OCC3CCC(C)CC3)/C(F)=C/F)CC2)CC1 |
| InChI | InChI=1S/C29H44F2O2/c1-3-23-10-14-26(15-11-23)27-16-12-25(13-17-27)21-33-29(28(31)19-30)5-4-18-32-20-24-8-6-22(2)7-9-24/h3-5,18-19,22-27H,1,6-17,20-21H2,2H3/b18-4+,28-19-,29-5+ |
| InChIKey | OYZGPKQDTKNSDY-HPWZOSNRSA-N |
| XLogP | 8.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|